C14H14N4O4S2 — CID 2008447
(3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2008447) has the molecular formula C14H14N4O4S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is (3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2008447 |
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (3R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C[C@@H](Sc3nnc(N)s3)C2=O)c1 |
| InChI | InChI=1S/C14H14N4O4S2/c1-21-8-3-7(4-9(5-8)22-2)18-11(19)6-10(12(18)20)23-14-17-16-13(15)24-14/h3-5,10H,6H2,1-2H3,(H2,15,16)/t10-/m1/s1 |
| InChIKey | OSOSCTKVNVHTFQ-SNVBAGLBSA-N |
| XLogP | 1.56 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|