C20H17ClN4O3S2 — CID 4876406
1-(3-chloro-2-methylphenyl)-3-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione (PubChem CID 4876406) has the molecular formula C20H17ClN4O3S2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4876406 |
| Molecular Formula | C20H17ClN4O3S2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(Nc2nnc(SC3CC(=O)N(c4cccc(Cl)c4C)C3=O)s2)cc1 |
| InChI | InChI=1S/C20H17ClN4O3S2/c1-11-14(21)4-3-5-15(11)25-17(26)10-16(18(25)27)29-20-24-23-19(30-20)22-12-6-8-13(28-2)9-7-12/h3-9,16H,10H2,1-2H3,(H,22,23) |
| InChIKey | DNGWMHZOCXJPLX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|