C19H15N3O3S2 — CID 1078930
(3S)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 1078930) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (3S)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1078930 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | (3S)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1nnc(S[C@H]2CC(=O)N(c3ccc(Oc4ccccc4)cc3)C2=O)s1 |
| InChI | InChI=1S/C19H15N3O3S2/c1-12-20-21-19(26-12)27-16-11-17(23)22(18(16)24)13-7-9-15(10-8-13)25-14-5-3-2-4-6-14/h2-10,16H,11H2,1H3/t16-/m0/s1 |
| InChIKey | LGJAYNQTQBXABU-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|