C19H15F2N5O2 — CID 98234939
(3R)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,4-difluorophenyl)pyrrolidine-2,5-dione (PubChem CID 98234939) has the molecular formula C19H15F2N5O2 and a molecular weight of 383.36 g/mol. Its IUPAC name is (3R)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,4-difluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,4-difluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98234939 |
| Molecular Formula | C19H15F2N5O2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (3R)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,4-difluorophenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1nn(-c2ccccn2)c(N)c1[C@H]1CC(=O)N(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C19H15F2N5O2/c1-10-17(18(22)26(24-10)15-4-2-3-7-23-15)12-9-16(27)25(19(12)28)11-5-6-13(20)14(21)8-11/h2-8,12H,9,22H2,1H3/t12-/m1/s1 |
| InChIKey | JVGIXJUSYUBRCM-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|