C21H21N5O4 — CID 95391005
(3S)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 95391005) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is (3S)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 95391005 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3S)-3-(5-amino-3-methyl-1-pyridin-2-ylpyrazol-4-yl)-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C[C@@H](c3c(C)nn(-c4ccccn4)c3N)C2=O)c1 |
| InChI | InChI=1S/C21H21N5O4/c1-12-19(20(22)26(24-12)17-6-4-5-7-23-17)16-11-18(27)25(21(16)28)13-8-14(29-2)10-15(9-13)30-3/h4-10,16H,11,22H2,1-3H3/t16-/m0/s1 |
| InChIKey | KEFIFYKLNYOILZ-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|