C22H20N4O5 — CID 52996793
3-[3-(5-amino-3-methyl-1-phenylpyrazol-4-yl)-2,5-dioxopyrrolidin-1-yl]-4-methoxybenzoic acid (PubChem CID 52996793) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-[3-(5-amino-3-methyl-1-phenylpyrazol-4-yl)-2,5-dioxopyrrolidin-1-yl]-4-methoxybenzoic acid.
| Compound Name | 3-[3-(5-amino-3-methyl-1-phenylpyrazol-4-yl)-2,5-dioxopyrrolidin-1-yl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 52996793 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[3-(5-amino-3-methyl-1-phenylpyrazol-4-yl)-2,5-dioxopyrrolidin-1-yl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1N1C(=O)CC(c2c(C)nn(-c3ccccc3)c2N)C1=O |
| InChI | InChI=1S/C22H20N4O5/c1-12-19(20(23)26(24-12)14-6-4-3-5-7-14)15-11-18(27)25(21(15)28)16-10-13(22(29)30)8-9-17(16)31-2/h3-10,15H,11,23H2,1-2H3,(H,29,30) |
| InChIKey | GEICKLFFUQTSJA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|