C20H21N3O5 — CID 2119915
3,4-dimethoxy-N'-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 2119915) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 2119915 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3,4-dimethoxy-N'-[(3R)-1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NN[C@@H]2CC(=O)N(c3ccccc3C)C2=O)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-12-6-4-5-7-15(12)23-18(24)11-14(20(23)26)21-22-19(25)13-8-9-16(27-2)17(10-13)28-3/h4-10,14,21H,11H2,1-3H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | VXBDEGOBFBPGQA-CQSZACIVSA-N |
| XLogP | 1.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|