C19H17N2O5- — CID 2126425
3-[[(3S)-1-(2-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-methylbenzoate (PubChem CID 2126425) has the molecular formula C19H17N2O5- and a molecular weight of 353.35 g/mol. Its IUPAC name is 3-[[(3S)-1-(2-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-methylbenzoate.
| Compound Name | 3-[[(3S)-1-(2-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 2126425 |
| Molecular Formula | C19H17N2O5- |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-[[(3S)-1-(2-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-methylbenzoate |
| SMILES | COc1ccccc1N1C(=O)C[C@H](Nc2cc(C(=O)[O-])ccc2C)C1=O |
| InChI | InChI=1S/C19H18N2O5/c1-11-7-8-12(19(24)25)9-13(11)20-14-10-17(22)21(18(14)23)15-5-3-4-6-16(15)26-2/h3-9,14,20H,10H2,1-2H3,(H,24,25)/p-1/t14-/m0/s1 |
| InChIKey | KTFHFFGAXPBKIY-AWEZNQCLSA-M |
| XLogP | 1.11 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|