C20H20N2O3 — CID 17078305
3-(2,3-dihydro-1H-inden-2-ylamino)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 17078305) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-ylamino)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-ylamino)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17078305 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-ylamino)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)CC(NC2Cc3ccccc3C2)C1=O |
| InChI | InChI=1S/C20H20N2O3/c1-25-18-9-5-4-8-17(18)22-19(23)12-16(20(22)24)21-15-10-13-6-2-3-7-14(13)11-15/h2-9,15-16,21H,10-12H2,1H3 |
| InChIKey | JVODDNPXVJJJQF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|