C20H20N2O5 — CID 51568688
3-[(3R)-3-(2-ethoxyanilino)-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid (PubChem CID 51568688) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[(3R)-3-(2-ethoxyanilino)-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-[(3R)-3-(2-ethoxyanilino)-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 51568688 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-[(3R)-3-(2-ethoxyanilino)-2,5-dioxopyrrolidin-1-yl]-4-methylbenzoic acid |
| SMILES | CCOc1ccccc1N[C@@H]1CC(=O)N(c2cc(C(=O)O)ccc2C)C1=O |
| InChI | InChI=1S/C20H20N2O5/c1-3-27-17-7-5-4-6-14(17)21-15-11-18(23)22(19(15)24)16-10-13(20(25)26)9-8-12(16)2/h4-10,15,21H,3,11H2,1-2H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | MVYRWNVQAOZTIT-OAHLLOKOSA-N |
| XLogP | 2.84 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|