C19H16ClN3O5 — CID 2119914
N'-[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 2119914) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is N'-[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 2119914 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N'-[(3S)-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | Cc1c(Cl)cccc1N1C(=O)C[C@H](NNC(=O)c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C19H16ClN3O5/c1-10-12(20)3-2-4-14(10)23-17(24)8-13(19(23)26)21-22-18(25)11-5-6-15-16(7-11)28-9-27-15/h2-7,13,21H,8-9H2,1H3,(H,22,25)/t13-/m0/s1 |
| InChIKey | UUJVJRVIZVOPSX-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|