C20H21FN2O4 — CID 167825068
3-[3-fluoro-4-(2-methoxyethoxy)anilino]-1-(2-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 167825068) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2-methoxyethoxy)anilino]-1-(2-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[3-fluoro-4-(2-methoxyethoxy)anilino]-1-(2-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167825068 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[3-fluoro-4-(2-methoxyethoxy)anilino]-1-(2-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | COCCOc1ccc(NC2CC(=O)N(c3ccccc3C)C2=O)cc1F |
| InChI | InChI=1S/C20H21FN2O4/c1-13-5-3-4-6-17(13)23-19(24)12-16(20(23)25)22-14-7-8-18(15(21)11-14)27-10-9-26-2/h3-8,11,16,22H,9-10,12H2,1-2H3 |
| InChIKey | BTCUVLAESRSVBC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|