C16H19NO2 — CID 40938680
(3R)-2-benzyl-3-methoxy-4,5,6,7-tetrahydro-3H-isoindol-1-one (PubChem CID 40938680) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R)-2-benzyl-3-methoxy-4,5,6,7-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3R)-2-benzyl-3-methoxy-4,5,6,7-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 40938680 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3R)-2-benzyl-3-methoxy-4,5,6,7-tetrahydro-3H-isoindol-1-one |
| SMILES | CO[C@@H]1C2=C(CCCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-19-16-14-10-6-5-9-13(14)15(18)17(16)11-12-7-3-2-4-8-12/h2-4,7-8,16H,5-6,9-11H2,1H3/t16-/m1/s1 |
| InChIKey | FVQXKAIXKBLPAI-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |