C20H23NO — CID 10990036
(1R,10S)-11-benzyl-11-azatricyclo[8.2.2.02,9]tetradeca-2(9),13-dien-12-one (PubChem CID 10990036) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (1R,10S)-11-benzyl-11-azatricyclo[8.2.2.02,9]tetradeca-2(9),13-dien-12-one.
| Compound Name | (1R,10S)-11-benzyl-11-azatricyclo[8.2.2.02,9]tetradeca-2(9),13-dien-12-one |
|---|---|
| PubChem CID | 10990036 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (1R,10S)-11-benzyl-11-azatricyclo[8.2.2.02,9]tetradeca-2(9),13-dien-12-one |
| SMILES | O=C1[C@@H]2C=C[C@@H](C3=C2CCCCCC3)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO/c22-20-18-12-13-19(17-11-7-2-1-6-10-16(17)18)21(20)14-15-8-4-3-5-9-15/h3-5,8-9,12-13,18-19H,1-2,6-7,10-11,14H2/t18-,19+/m1/s1 |
| InChIKey | CJWAAJRYDGUREK-MOPGFXCFSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|