C24H23N3OS — CID 172686647
2-imino-5-[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]-1,3-thiazolidin-4-one (PubChem CID 172686647) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-imino-5-[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-5-[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 172686647 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-imino-5-[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(c2cccc(C(N[C@H](C)c3ccccc3)c3ccccc3)c2)S1 |
| InChI | InChI=1S/C24H23N3OS/c1-16(17-9-4-2-5-10-17)26-21(18-11-6-3-7-12-18)19-13-8-14-20(15-19)22-23(28)27-24(25)29-22/h2-16,21-22,26H,1H3,(H2,25,27,28)/t16-,21?,22?/m1/s1 |
| InChIKey | BCWBLOPJCXJMMZ-NYYVNYEXSA-N |
| XLogP | 4.97 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|