C44H38N2O2S — CID 139837970
5-[[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 139837970) has the molecular formula C44H38N2O2S and a molecular weight of 658.87 g/mol. Its IUPAC name is 5-[[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837970 |
| Molecular Formula | C44H38N2O2S |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 5-[[3-[phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@@H](NC(c1ccccc1)c1cccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C44H38N2O2S/c1-32(34-19-7-2-8-20-34)45-41(35-21-9-3-10-22-35)36-23-17-18-33(30-36)31-40-42(47)46(43(48)49-40)44(37-24-11-4-12-25-37,38-26-13-5-14-27-38)39-28-15-6-16-29-39/h2-30,32,40-41,45H,31H2,1H3/t32-,40?,41?/m1/s1 |
| InChIKey | FVTMAYXFFZERLZ-KPRLPMLOSA-N |
| XLogP | 9.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|