C29H26N2O2S — CID 139837865
5-[[3-[[[(1S)-1-naphthalen-1-ylethyl]amino]-phenylmethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139837865) has the molecular formula C29H26N2O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is 5-[[3-[[[(1S)-1-naphthalen-1-ylethyl]amino]-phenylmethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[[[(1S)-1-naphthalen-1-ylethyl]amino]-phenylmethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837865 |
| Molecular Formula | C29H26N2O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-[[3-[[[(1S)-1-naphthalen-1-ylethyl]amino]-phenylmethyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H](NC(c1ccccc1)c1cccc(CC2SC(=O)NC2=O)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H26N2O2S/c1-19(24-16-8-13-21-10-5-6-15-25(21)24)30-27(22-11-3-2-4-12-22)23-14-7-9-20(17-23)18-26-28(32)31-29(33)34-26/h2-17,19,26-27,30H,18H2,1H3,(H,31,32,33)/t19-,26?,27?/m0/s1 |
| InChIKey | FIXYENRWBNMFRS-NVJGINGZSA-N |
| XLogP | 6.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|