C26H26N2O2S — CID 139837957
5-[[3-[phenyl-[[(1R)-1-phenylpropyl]amino]methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139837957) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 5-[[3-[phenyl-[[(1R)-1-phenylpropyl]amino]methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[phenyl-[[(1R)-1-phenylpropyl]amino]methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837957 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-[[3-[phenyl-[[(1R)-1-phenylpropyl]amino]methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@@H](NC(c1ccccc1)c1cccc(CC2SC(=O)NC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-2-22(19-11-5-3-6-12-19)27-24(20-13-7-4-8-14-20)21-15-9-10-18(16-21)17-23-25(29)28-26(30)31-23/h3-16,22-24,27H,2,17H2,1H3,(H,28,29,30)/t22-,23?,24?/m1/s1 |
| InChIKey | DOWJHUWAHAKYKR-ZKMFCFPVSA-N |
| XLogP | 5.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|