C32H36N2O3S — CID 139837948
5-[[3-[[1-(4-cyclohexylphenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139837948) has the molecular formula C32H36N2O3S and a molecular weight of 528.72 g/mol. Its IUPAC name is 5-[[3-[[1-(4-cyclohexylphenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[[1-(4-cyclohexylphenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837948 |
| Molecular Formula | C32H36N2O3S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 5-[[3-[[1-(4-cyclohexylphenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(NC(C)c2ccc(C3CCCCC3)cc2)c2cccc(CC3SC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C32H36N2O3S/c1-21(23-11-13-25(14-12-23)24-8-4-3-5-9-24)33-30(26-15-17-28(37-2)18-16-26)27-10-6-7-22(19-27)20-29-31(35)34-32(36)38-29/h6-7,10-19,21,24,29-30,33H,3-5,8-9,20H2,1-2H3,(H,34,35,36) |
| InChIKey | PWHGHXYQJVHQKL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|