C20H36N6O3S — CID 144639218
1,1-dimethyl-2-(N'-methylcarbamimidoyl)guanidine;ethane;5-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 144639218) has the molecular formula C20H36N6O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is 1,1-dimethyl-2-(N'-methylcarbamimidoyl)guanidine;ethane;5-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 1,1-dimethyl-2-(N'-methylcarbamimidoyl)guanidine;ethane;5-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 144639218 |
| Molecular Formula | C20H36N6O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1,1-dimethyl-2-(N'-methylcarbamimidoyl)guanidine;ethane;5-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C/N=C(N)/N=C(\N)N(C)C.CC.CC.COc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H11NO3S.C5H13N5.2C2H6/c1-15-8-4-2-7(3-5-8)6-9-10(13)12-11(14)16-9;1-8-4(6)9-5(7)10(2)3;2*1-2/h2-5,9H,6H2,1H3,(H,12,13,14);1-3H3,(H4,6,7,8,9);2*1-2H3 |
| InChIKey | GVPDMLAHRFHPKP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|