C19H21NO9S2 — CID 53354542
5-[[4-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid (PubChem CID 53354542) has the molecular formula C19H21NO9S2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-[[4-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid.
| Compound Name | 5-[[4-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid |
|---|---|
| PubChem CID | 53354542 |
| Molecular Formula | C19H21NO9S2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 5-[[4-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid |
| SMILES | COc1ccc([C@@H](O)COc2ccc(CC3SC(=O)NC3=O)cc2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C19H19NO5S.H2O4S/c1-24-14-8-4-13(5-9-14)16(21)11-25-15-6-2-12(3-7-15)10-17-18(22)20-19(23)26-17;1-5(2,3)4/h2-9,16-17,21H,10-11H2,1H3,(H,20,22,23);(H2,1,2,3,4)/t16-,17?;/m0./s1 |
| InChIKey | UQHLPSRZONQGKN-KHTASDDNSA-N |
| XLogP | 2.05 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|