C23H25NO6S — CID 88929157
[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-(3-methoxyphenyl)propyl] propanoate (PubChem CID 88929157) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-(3-methoxyphenyl)propyl] propanoate.
| Compound Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-(3-methoxyphenyl)propyl] propanoate |
|---|---|
| PubChem CID | 88929157 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-(3-methoxyphenyl)propyl] propanoate |
| SMILES | CCC(=O)OCC(COc1ccc(CC2SC(=O)NC2=O)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H25NO6S/c1-3-21(25)30-14-17(16-5-4-6-19(12-16)28-2)13-29-18-9-7-15(8-10-18)11-20-22(26)24-23(27)31-20/h4-10,12,17,20H,3,11,13-14H2,1-2H3,(H,24,26,27) |
| InChIKey | VZGAFICGAIVUEP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|