C22H20ClNO7S — CID 46911301
4-[(1S)-1-(3-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 46911301) has the molecular formula C22H20ClNO7S and a molecular weight of 477.92 g/mol. Its IUPAC name is 4-[(1S)-1-(3-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(1S)-1-(3-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 46911301 |
| Molecular Formula | C22H20ClNO7S |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 4-[(1S)-1-(3-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)O[C@H](COc1ccc(CC2SC(=O)NC2=O)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClNO7S/c23-15-3-1-2-14(11-15)17(31-20(27)9-8-19(25)26)12-30-16-6-4-13(5-7-16)10-18-21(28)24-22(29)32-18/h1-7,11,17-18H,8-10,12H2,(H,25,26)(H,24,28,29)/t17-,18?/m1/s1 |
| InChIKey | ZRMZOUOUQSNNIA-QNSVNVJESA-N |
| XLogP | 3.76 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|