C25H31ClN2O5S — CID 53353928
[(1R)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(6-ethyl-3-pyridinyl)ethyl] hexanoate;hydrochloride (PubChem CID 53353928) has the molecular formula C25H31ClN2O5S and a molecular weight of 507.05 g/mol. Its IUPAC name is [(1R)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(6-ethyl-3-pyridinyl)ethyl] hexanoate;hydrochloride.
| Compound Name | [(1R)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(6-ethyl-3-pyridinyl)ethyl] hexanoate;hydrochloride |
|---|---|
| PubChem CID | 53353928 |
| Molecular Formula | C25H31ClN2O5S |
| Molecular Weight | 507.05 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | [(1R)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(6-ethyl-3-pyridinyl)ethyl] hexanoate;hydrochloride |
| SMILES | CCCCCC(=O)O[C@@H](COc1ccc(CC2SC(=O)NC2=O)cc1)c1ccc(CC)nc1.Cl |
| InChI | InChI=1S/C25H30N2O5S.ClH/c1-3-5-6-7-23(28)32-21(18-10-11-19(4-2)26-15-18)16-31-20-12-8-17(9-13-20)14-22-24(29)27-25(30)33-22;/h8-13,15,21-22H,3-7,14,16H2,1-2H3,(H,27,29,30);1H/t21-,22?;/m0./s1 |
| InChIKey | LELPEKSNINMHGX-GYFCLUQUSA-N |
| XLogP | 5.20 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.05 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|