C26H31NO6S — CID 46911354
[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(4-methylphenyl)ethoxy]methyl hexanoate (PubChem CID 46911354) has the molecular formula C26H31NO6S and a molecular weight of 485.60 g/mol. Its IUPAC name is [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(4-methylphenyl)ethoxy]methyl hexanoate.
| Compound Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(4-methylphenyl)ethoxy]methyl hexanoate |
|---|---|
| PubChem CID | 46911354 |
| Molecular Formula | C26H31NO6S |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(4-methylphenyl)ethoxy]methyl hexanoate |
| SMILES | CCCCCC(=O)OCOC(COc1ccc(CC2SC(=O)NC2=O)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31NO6S/c1-3-4-5-6-24(28)33-17-32-22(20-11-7-18(2)8-12-20)16-31-21-13-9-19(10-14-21)15-23-25(29)27-26(30)34-23/h7-14,22-23H,3-6,15-17H2,1-2H3,(H,27,29,30) |
| InChIKey | XJQXXHTXPFJBDI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|