C21H24N2O5S — CID 130308111
5-[[4-[(2S)-2-(5-ethyl-2-pyridinyl)-2-(1-hydroxyethoxy)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 130308111) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-[[4-[(2S)-2-(5-ethyl-2-pyridinyl)-2-(1-hydroxyethoxy)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(2S)-2-(5-ethyl-2-pyridinyl)-2-(1-hydroxyethoxy)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130308111 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-[[4-[(2S)-2-(5-ethyl-2-pyridinyl)-2-(1-hydroxyethoxy)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc([C@@H](COc2ccc(CC3SC(=O)NC3=O)cc2)OC(C)O)nc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-3-14-6-9-17(22-11-14)18(28-13(2)24)12-27-16-7-4-15(5-8-16)10-19-20(25)23-21(26)29-19/h4-9,11,13,18-19,24H,3,10,12H2,1-2H3,(H,23,25,26)/t13?,18-,19?/m1/s1 |
| InChIKey | MTEHZKOKZJWGFR-HRJVKACCSA-N |
| XLogP | 3.01 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|