C20H22N2NaO4S+ — CID 23325415
sodium 5-[[4-[2-(5-ethyl-2-pyridinyl)-3-hydroxypropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 23325415) has the molecular formula C20H22N2NaO4S+ and a molecular weight of 409.46 g/mol. Its IUPAC name is sodium 5-[[4-[2-(5-ethyl-2-pyridinyl)-3-hydroxypropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | sodium 5-[[4-[2-(5-ethyl-2-pyridinyl)-3-hydroxypropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23325415 |
| Molecular Formula | C20H22N2NaO4S+ |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | sodium 5-[[4-[2-(5-ethyl-2-pyridinyl)-3-hydroxypropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc(C(CO)COc2ccc(CC3SC(=O)NC3=O)cc2)nc1.[Na+] |
| InChI | InChI=1S/C20H22N2O4S.Na/c1-2-13-5-8-17(21-10-13)15(11-23)12-26-16-6-3-14(4-7-16)9-18-19(24)22-20(25)27-18;/h3-8,10,15,18,23H,2,9,11-12H2,1H3,(H,22,24,25);/q;+1 |
| InChIKey | YMBBWHVPEMLUHU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|