C23H22ClNO7S — CID 123989086
4-[1-(3-chlorophenyl)-2-[4-[(3,6-dioxothiomorpholin-2-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 123989086) has the molecular formula C23H22ClNO7S and a molecular weight of 491.95 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)-2-[4-[(3,6-dioxothiomorpholin-2-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[1-(3-chlorophenyl)-2-[4-[(3,6-dioxothiomorpholin-2-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123989086 |
| Molecular Formula | C23H22ClNO7S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 4-[1-(3-chlorophenyl)-2-[4-[(3,6-dioxothiomorpholin-2-yl)methyl]phenoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC(COc1ccc(CC2SC(=O)CNC2=O)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClNO7S/c24-16-3-1-2-15(11-16)18(32-21(28)9-8-20(26)27)13-31-17-6-4-14(5-7-17)10-19-23(30)25-12-22(29)33-19/h1-7,11,18-19H,8-10,12-13H2,(H,25,30)(H,26,27) |
| InChIKey | MYXKXFZSGZSERZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|