C27H32O6S — CID 71100700
[(1S)-2-[4-[(3,5-dioxothiolan-2-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] heptanoate (PubChem CID 71100700) has the molecular formula C27H32O6S and a molecular weight of 484.61 g/mol. Its IUPAC name is [(1S)-2-[4-[(3,5-dioxothiolan-2-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] heptanoate.
| Compound Name | [(1S)-2-[4-[(3,5-dioxothiolan-2-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] heptanoate |
|---|---|
| PubChem CID | 71100700 |
| Molecular Formula | C27H32O6S |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(1S)-2-[4-[(3,5-dioxothiolan-2-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@H](COc1ccc(CC2SC(=O)CC2=O)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H32O6S/c1-3-4-5-6-10-26(29)33-24(20-8-7-9-22(16-20)31-2)18-32-21-13-11-19(12-14-21)15-25-23(28)17-27(30)34-25/h7-9,11-14,16,24-25H,3-6,10,15,17-18H2,1-2H3/t24-,25?/m1/s1 |
| InChIKey | JDSPJLIIYSKUNE-IKOFQBKESA-N |
| XLogP | 5.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|