C19H18KNO5S — CID 53353442
potassium 5-[[4-[(2R)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione (PubChem CID 53353442) has the molecular formula C19H18KNO5S and a molecular weight of 411.52 g/mol. Its IUPAC name is potassium 5-[[4-[(2R)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione.
| Compound Name | potassium 5-[[4-[(2R)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
|---|---|
| PubChem CID | 53353442 |
| Molecular Formula | C19H18KNO5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | potassium 5-[[4-[(2R)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
| SMILES | COc1cccc([C@@H](O)COc2ccc(CC3SC(=O)[N-]C3=O)cc2)c1.[K+] |
| InChI | InChI=1S/C19H19NO5S.K/c1-24-15-4-2-3-13(10-15)16(21)11-25-14-7-5-12(6-8-14)9-17-18(22)20-19(23)26-17;/h2-8,10,16-17,21H,9,11H2,1H3,(H,20,22,23);/q;+1/p-1/t16-,17?;/m0./s1 |
| InChIKey | ZCFGGHHSBOBCGQ-KHTASDDNSA-M |
| XLogP | 0.49 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|