C26H36N2O5S — CID 144646118
[(1R)-1-(6-ethyl-1-methyl-2H-pyridin-3-yl)-2-[4-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] hexanoate (PubChem CID 144646118) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is [(1R)-1-(6-ethyl-1-methyl-2H-pyridin-3-yl)-2-[4-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] hexanoate.
| Compound Name | [(1R)-1-(6-ethyl-1-methyl-2H-pyridin-3-yl)-2-[4-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] hexanoate |
|---|---|
| PubChem CID | 144646118 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [(1R)-1-(6-ethyl-1-methyl-2H-pyridin-3-yl)-2-[4-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H](COc1ccc(CC2SC(O)NC2=O)cc1)C1=CC=C(CC)N(C)C1 |
| InChI | InChI=1S/C26H36N2O5S/c1-4-6-7-8-24(29)33-22(19-11-12-20(5-2)28(3)16-19)17-32-21-13-9-18(10-14-21)15-23-25(30)27-26(31)34-23/h9-14,22-23,26,31H,4-8,15-17H2,1-3H3,(H,27,30)/t22-,23?,26?/m0/s1 |
| InChIKey | SGBIAXLBLMQYPX-MFNHVEPQSA-N |
| XLogP | 3.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|