C25H22ClNO4S — CID 127027728
5-[[4-[(3S)-3-(4-chlorophenoxy)-3-phenylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 127027728) has the molecular formula C25H22ClNO4S and a molecular weight of 467.97 g/mol. Its IUPAC name is 5-[[4-[(3S)-3-(4-chlorophenoxy)-3-phenylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(3S)-3-(4-chlorophenoxy)-3-phenylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 127027728 |
| Molecular Formula | C25H22ClNO4S |
| Molecular Weight | 467.97 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 5-[[4-[(3S)-3-(4-chlorophenoxy)-3-phenylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCC[C@H](Oc3ccc(Cl)cc3)c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C25H22ClNO4S/c26-19-8-12-21(13-9-19)31-22(18-4-2-1-3-5-18)14-15-30-20-10-6-17(7-11-20)16-23-24(28)27-25(29)32-23/h1-13,22-23H,14-16H2,(H,27,28,29)/t22-,23?/m0/s1 |
| InChIKey | FGXYHUMUGYXNOX-NQCNTLBGSA-N |
| XLogP | 5.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|