C20H18ClNO5S — CID 75251449
[1-(2-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] acetate (PubChem CID 75251449) has the molecular formula C20H18ClNO5S and a molecular weight of 419.89 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] acetate.
| Compound Name | [1-(2-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] acetate |
|---|---|
| PubChem CID | 75251449 |
| Molecular Formula | C20H18ClNO5S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | [1-(2-chlorophenyl)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl] acetate |
| SMILES | CC(=O)OC(COc1ccc(CC2SC(=O)NC2=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClNO5S/c1-12(23)27-17(15-4-2-3-5-16(15)21)11-26-14-8-6-13(7-9-14)10-18-19(24)22-20(25)28-18/h2-9,17-18H,10-11H2,1H3,(H,22,24,25) |
| InChIKey | IJZOKWQDTNLMCI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|