C19H17ClO4S — CID 71100604
5-[[4-[2-(2-chlorophenyl)-2-hydroxyethoxy]phenyl]methyl]thiolane-2,4-dione (PubChem CID 71100604) has the molecular formula C19H17ClO4S and a molecular weight of 376.86 g/mol. Its IUPAC name is 5-[[4-[2-(2-chlorophenyl)-2-hydroxyethoxy]phenyl]methyl]thiolane-2,4-dione.
| Compound Name | 5-[[4-[2-(2-chlorophenyl)-2-hydroxyethoxy]phenyl]methyl]thiolane-2,4-dione |
|---|---|
| PubChem CID | 71100604 |
| Molecular Formula | C19H17ClO4S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-[[4-[2-(2-chlorophenyl)-2-hydroxyethoxy]phenyl]methyl]thiolane-2,4-dione |
| SMILES | O=C1CC(=O)C(Cc2ccc(OCC(O)c3ccccc3Cl)cc2)S1 |
| InChI | InChI=1S/C19H17ClO4S/c20-15-4-2-1-3-14(15)17(22)11-24-13-7-5-12(6-8-13)9-18-16(21)10-19(23)25-18/h1-8,17-18,22H,9-11H2 |
| InChIKey | BQRRPPKNVLEPHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|