C18H19N3O3S — CID 158207999
5-[[4-[2-[amino(pyridin-2-yl)amino]ethoxy]phenyl]methyl]thiolane-2,4-dione (PubChem CID 158207999) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 5-[[4-[2-[amino(pyridin-2-yl)amino]ethoxy]phenyl]methyl]thiolane-2,4-dione.
| Compound Name | 5-[[4-[2-[amino(pyridin-2-yl)amino]ethoxy]phenyl]methyl]thiolane-2,4-dione |
|---|---|
| PubChem CID | 158207999 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-[[4-[2-[amino(pyridin-2-yl)amino]ethoxy]phenyl]methyl]thiolane-2,4-dione |
| SMILES | NN(CCOc1ccc(CC2SC(=O)CC2=O)cc1)c1ccccn1 |
| InChI | InChI=1S/C18H19N3O3S/c19-21(17-3-1-2-8-20-17)9-10-24-14-6-4-13(5-7-14)11-16-15(22)12-18(23)25-16/h1-8,16H,9-12,19H2 |
| InChIKey | FMXMKMFCMATAEF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|