C19H21NO5S — CID 130308065
5-[[4-[(2R)-2-hydroxy-2-(3-methoxycyclohexa-1,5-dien-1-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 130308065) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-[[4-[(2R)-2-hydroxy-2-(3-methoxycyclohexa-1,5-dien-1-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(2R)-2-hydroxy-2-(3-methoxycyclohexa-1,5-dien-1-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130308065 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 5-[[4-[(2R)-2-hydroxy-2-(3-methoxycyclohexa-1,5-dien-1-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COC1C=C([C@@H](O)COc2ccc(CC3SC(=O)NC3=O)cc2)C=CC1 |
| InChI | InChI=1S/C19H21NO5S/c1-24-15-4-2-3-13(10-15)16(21)11-25-14-7-5-12(6-8-14)9-17-18(22)20-19(23)26-17/h2-3,5-8,10,15-17,21H,4,9,11H2,1H3,(H,20,22,23)/t15?,16-,17?/m0/s1 |
| InChIKey | FZBSJOVQAUWDRV-CGZBRXJRSA-N |
| XLogP | 2.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|