C19H22N2O4S — CID 130308054
5-[[4-[(2S)-2-(5-ethyl-1,2-dihydropyridin-2-yl)-2-hydroxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 130308054) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 5-[[4-[(2S)-2-(5-ethyl-1,2-dihydropyridin-2-yl)-2-hydroxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(2S)-2-(5-ethyl-1,2-dihydropyridin-2-yl)-2-hydroxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 130308054 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-[[4-[(2S)-2-(5-ethyl-1,2-dihydropyridin-2-yl)-2-hydroxyethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCC1=CNC([C@H](O)COc2ccc(CC3SC(=O)NC3=O)cc2)C=C1 |
| InChI | InChI=1S/C19H22N2O4S/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17/h3-8,10,15-17,20,22H,2,9,11H2,1H3,(H,21,23,24)/t15?,16-,17?/m1/s1 |
| InChIKey | PVWWCZBXQFLTJT-AQFXKWCLSA-N |
| XLogP | 2.14 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|