C26H25BrN2O3S — CID 139837878
5-[[3-[[[(1R)-1-(4-bromophenyl)ethyl]amino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139837878) has the molecular formula C26H25BrN2O3S and a molecular weight of 525.47 g/mol. Its IUPAC name is 5-[[3-[[[(1R)-1-(4-bromophenyl)ethyl]amino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[[[(1R)-1-(4-bromophenyl)ethyl]amino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837878 |
| Molecular Formula | C26H25BrN2O3S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 5-[[3-[[[(1R)-1-(4-bromophenyl)ethyl]amino]-(4-methoxyphenyl)methyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(N[C@H](C)c2ccc(Br)cc2)c2cccc(CC3SC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C26H25BrN2O3S/c1-16(18-6-10-21(27)11-7-18)28-24(19-8-12-22(32-2)13-9-19)20-5-3-4-17(14-20)15-23-25(30)29-26(31)33-23/h3-14,16,23-24,28H,15H2,1-2H3,(H,29,30,31)/t16-,23?,24?/m1/s1 |
| InChIKey | DIAWOMYEONPNRG-INTLSFHXSA-N |
| XLogP | 5.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|