C22H23NO — CID 131851990
[3-[(R)-phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol (PubChem CID 131851990) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is [3-[(R)-phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol.
| Compound Name | [3-[(R)-phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 131851990 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [3-[(R)-phenyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol |
| SMILES | C[C@@H](N[C@H](c1ccccc1)c1cccc(CO)c1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO/c1-17(19-10-4-2-5-11-19)23-22(20-12-6-3-7-13-20)21-14-8-9-18(15-21)16-24/h2-15,17,22-24H,16H2,1H3/t17-,22-/m1/s1 |
| InChIKey | XKQBYHORXXWCOJ-VGOFRKELSA-N |
| XLogP | 4.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |