C22H29NO — CID 131851993
[3-[cyclohexyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol (PubChem CID 131851993) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is [3-[cyclohexyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol.
| Compound Name | [3-[cyclohexyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 131851993 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | [3-[cyclohexyl-[[(1R)-1-phenylethyl]amino]methyl]phenyl]methanol |
| SMILES | C[C@@H](NC(c1cccc(CO)c1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO/c1-17(19-10-4-2-5-11-19)23-22(20-12-6-3-7-13-20)21-14-8-9-18(15-21)16-24/h2,4-5,8-11,14-15,17,20,22-24H,3,6-7,12-13,16H2,1H3/t17-,22?/m1/s1 |
| InChIKey | WVTGEPXJJIFNJO-PLEWWHCXSA-N |
| XLogP | 5.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |