C27H24F2N2O4S — CID 139837980
2-(3,4-difluorophenyl)-N-[[3-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-(4-methoxyphenyl)methyl]propanamide (PubChem CID 139837980) has the molecular formula C27H24F2N2O4S and a molecular weight of 510.56 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[[3-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[[3-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 139837980 |
| Molecular Formula | C27H24F2N2O4S |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[[3-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(C(NC(=O)C(C)c2ccc(F)c(F)c2)c2cccc(CC3SC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C27H24F2N2O4S/c1-15(18-8-11-21(28)22(29)14-18)25(32)30-24(17-6-9-20(35-2)10-7-17)19-5-3-4-16(12-19)13-23-26(33)31-27(34)36-23/h3-12,14-15,23-24H,13H2,1-2H3,(H,30,32)(H,31,33,34) |
| InChIKey | LLZRZLFCIIMNIC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|