C26H24F2N2O3S — CID 139837969
5-[[5-[[1-(3,4-difluorophenyl)ethylamino]-phenylmethyl]-2-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139837969) has the molecular formula C26H24F2N2O3S and a molecular weight of 482.55 g/mol. Its IUPAC name is 5-[[5-[[1-(3,4-difluorophenyl)ethylamino]-phenylmethyl]-2-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-[[1-(3,4-difluorophenyl)ethylamino]-phenylmethyl]-2-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837969 |
| Molecular Formula | C26H24F2N2O3S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 5-[[5-[[1-(3,4-difluorophenyl)ethylamino]-phenylmethyl]-2-methoxyphenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C(NC(C)c2ccc(F)c(F)c2)c2ccccc2)cc1CC1SC(=O)NC1=O |
| InChI | InChI=1S/C26H24F2N2O3S/c1-15(17-8-10-20(27)21(28)13-17)29-24(16-6-4-3-5-7-16)18-9-11-22(33-2)19(12-18)14-23-25(31)30-26(32)34-23/h3-13,15,23-24,29H,14H2,1-2H3,(H,30,31,32) |
| InChIKey | QTDXEVWLGZHPMD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|