C26H24F2N2O2S2 — CID 139838001
5-[[3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 139838001) has the molecular formula C26H24F2N2O2S2 and a molecular weight of 498.62 g/mol. Its IUPAC name is 5-[[3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 139838001 |
| Molecular Formula | C26H24F2N2O2S2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 5-[[3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C(NC(C)c2ccc(F)c(F)c2)c2cccc(CC3SC(=S)NC3=O)c2)cc1 |
| InChI | InChI=1S/C26H24F2N2O2S2/c1-15(18-8-11-21(27)22(28)14-18)29-24(17-6-9-20(32-2)10-7-17)19-5-3-4-16(12-19)13-23-25(31)30-26(33)34-23/h3-12,14-15,23-24,29H,13H2,1-2H3,(H,30,31,33) |
| InChIKey | FYUYGUKKYYLZNI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|