C26H25NO — CID 101211100
2-[(1R)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-phenylethyl]phenol (PubChem CID 101211100) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[(1R)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-phenylethyl]phenol.
| Compound Name | 2-[(1R)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-phenylethyl]phenol |
|---|---|
| PubChem CID | 101211100 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[(1R)-1-[[(1S)-1-naphthalen-1-ylethyl]amino]-2-phenylethyl]phenol |
| SMILES | C[C@H](N[C@H](Cc1ccccc1)c1ccccc1O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H25NO/c1-19(22-16-9-13-21-12-5-6-14-23(21)22)27-25(18-20-10-3-2-4-11-20)24-15-7-8-17-26(24)28/h2-17,19,25,27-28H,18H2,1H3/t19-,25+/m0/s1 |
| InChIKey | FFLRTZGRMCJKQV-UQBPGWFLSA-N |
| XLogP | 6.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|