C22H26N2O — CID 142662293
(2S)-3-amino-1-[[(1R)-1-naphthalen-1-ylethyl]amino]-4-phenylbutan-2-ol (PubChem CID 142662293) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S)-3-amino-1-[[(1R)-1-naphthalen-1-ylethyl]amino]-4-phenylbutan-2-ol.
| Compound Name | (2S)-3-amino-1-[[(1R)-1-naphthalen-1-ylethyl]amino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 142662293 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2S)-3-amino-1-[[(1R)-1-naphthalen-1-ylethyl]amino]-4-phenylbutan-2-ol |
| SMILES | C[C@@H](NC[C@H](O)C(N)Cc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H26N2O/c1-16(19-13-7-11-18-10-5-6-12-20(18)19)24-15-22(25)21(23)14-17-8-3-2-4-9-17/h2-13,16,21-22,24-25H,14-15,23H2,1H3/t16-,21?,22+/m1/s1 |
| InChIKey | ZXPRJEUNEIWXIO-OBLXYAIXSA-N |
| XLogP | 3.42 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |