C20H20ClNO — CID 42942251
1-(4-chlorophenyl)-2-(1-naphthalen-1-ylethylamino)ethanol (PubChem CID 42942251) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(1-naphthalen-1-ylethylamino)ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-(1-naphthalen-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 42942251 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(1-naphthalen-1-ylethylamino)ethanol |
| SMILES | CC(NCC(O)c1ccc(Cl)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H20ClNO/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)22-13-20(23)16-9-11-17(21)12-10-16/h2-12,14,20,22-23H,13H2,1H3 |
| InChIKey | XZJTZGSDLROZNL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |