C25H22N2O2S — CID 139837932
5-[[3-[phenyl-[[(1S)-1-phenylethyl]amino]methyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 139837932) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 5-[[3-[phenyl-[[(1S)-1-phenylethyl]amino]methyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[phenyl-[[(1S)-1-phenylethyl]amino]methyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139837932 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[[3-[phenyl-[[(1S)-1-phenylethyl]amino]methyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H](NC(c1ccccc1)c1cccc(C=C2SC(=O)NC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2S/c1-17(19-10-4-2-5-11-19)26-23(20-12-6-3-7-13-20)21-14-8-9-18(15-21)16-22-24(28)27-25(29)30-22/h2-17,23,26H,1H3,(H,27,28,29)/t17-,23?/m0/s1 |
| InChIKey | GRMDZYDOTQVQOK-NVHKAFQKSA-N |
| XLogP | 5.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|