C13H12N2O3S2 — CID 124632022
2-oxo-2-[(5R)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 124632022) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-oxo-2-[(5R)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-oxo-2-[(5R)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 124632022 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-oxo-2-[(5R)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)C(=O)[C@H]1SC(=S)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O3S2/c1-7(8-5-3-2-4-6-8)14-11(17)9(16)10-12(18)15-13(19)20-10/h2-7,10H,1H3,(H,14,17)(H,15,18,19)/t7-,10+/m0/s1 |
| InChIKey | GSQHZOIFZZDYIS-OIBJUYFYSA-N |
| XLogP | 0.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|