C30H21NO3S — CID 41339526
[4-[(11S)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-methylbenzoate (PubChem CID 41339526) has the molecular formula C30H21NO3S and a molecular weight of 475.57 g/mol. Its IUPAC name is [4-[(11S)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(11S)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 41339526 |
| Molecular Formula | C30H21NO3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [4-[(11S)-12-oxo-5,11-dihydroindeno[2,1-c][1,5]benzothiazepin-11-yl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc([C@@H]3Sc4ccccc4NC4=C3C(=O)c3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C30H21NO3S/c1-18-10-12-20(13-11-18)30(33)34-21-16-14-19(15-17-21)29-26-27(22-6-2-3-7-23(22)28(26)32)31-24-8-4-5-9-25(24)35-29/h2-17,29,31H,1H3/t29-/m0/s1 |
| InChIKey | YLVGXNSYWBDKEP-LJAQVGFWSA-N |
| XLogP | 7.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|