C19H15NO2S — CID 937360
(4S)-4-(3,4-dimethylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione (PubChem CID 937360) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione.
| Compound Name | (4S)-4-(3,4-dimethylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione |
|---|---|
| PubChem CID | 937360 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (4S)-4-(3,4-dimethylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione |
| SMILES | Cc1ccc([C@@H]2SC(=O)NC3=C2C(=O)c2ccccc23)cc1C |
| InChI | InChI=1S/C19H15NO2S/c1-10-7-8-12(9-11(10)2)18-15-16(20-19(22)23-18)13-5-3-4-6-14(13)17(15)21/h3-9,18H,1-2H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | NAQDFTWFOQGAGA-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|